Learning Outcomes
- Derive reaction quotients from chemical equations representing homogeneous and heterogeneous reactions
- Calculate values of reaction quotients and equilibrium constants, using concentrations and pressures
- Relate the magnitude of an equilibrium constant to properties of the chemical system
The status of a reversible reaction is conveniently assessed by evaluating its reaction quotient (Q). For a reversible reaction described by
mA+nB+⇌xC+yDmA+nB+⇌xC+yD
the reaction quotient is derived directly from the stoichiometry of the balanced equation as
Qc=[C]x[D]y[A]m[B]nQc=[C]x[D]y[A]m[B]n
where the subscript c denotes the use of molar concentrations in the expression. If the reactants and products are gaseous, a reaction quotient may be similarly derived using partial pressures:
Note that the reaction quotient equations above are a simplification of more rigorous expressions that use relative values for concentrations and pressures rather than absolute values. These relative concentration and pressure values are dimensionless (they have no units); consequently, so are the reaction quotients. For purposes of this introductory text, it will suffice to use the simplified equations and to disregard units when computing Q. In most cases, this will introduce only modest errors in calculations involving reaction quotients.
Example 1: Writing Reaction Quotient Expressions
Write the expression for the reaction quotient for each of the following reactions:
- 3O2(g)⇌2O3(g)3O2(g)⇌2O3(g)
- N2(g)+3H2(g)⇌2NH3(g)N2(g)+3H2(g)⇌2NH3(g)
- 4NH3(g)+7O2(g)⇌4NO2(g)+6H2O(g)4NH3(g)+7O2(g)⇌4NO2(g)+6H2O(g)
Check Your Learning
Write the expression for the reaction quotient for each of the following reactions:
- 2SO2(g)+O2(g)⇌2SO3(g)2SO2(g)+O2(g)⇌2SO3(g)
- C4H8(g)⇌2C2H4(g)C4H8(g)⇌2C2H4(g)
- 2C4H10(g)+13O2(g)⇌8CO2(g)+10H2O(g)2C4H10(g)+13O2(g)⇌8CO2(g)+10H2O(g)
FIgure 1. Changes in concentrations and Qc for a chemical equilibrium achieved beginning with (a) a mixture of reactants only and (b) products only.
The numerical value of Q varies as a reaction proceeds towards equilibrium; therefore, it can serve as a useful indicator of the reaction’s status. To illustrate this point, consider the oxidation of sulfur dioxide:
Two different experimental scenarios are depicted in Figure 1, one in which this reaction is initiated with a mixture of reactants only, SO2 and O2, and another that begins with only product, SO3. For the reaction that begins with a mixture of reactants only, Q is initially equal to zero:
As the reaction proceeds toward equilibrium in the forward direction, reactant concentrations decrease (as does the denominator of Qc), product concentration increases (as does the numerator of Qc), and the reaction quotient consequently increases. When equilibrium is achieved, the concentrations of reactants and product remain constant, as does the value of Qc.
If the reaction begins with only product present, the value of Qc is initially undefined (immeasurably large, or infinite):
In this case, the reaction proceeds toward equilibrium in the reverse direction. The product concentration and the numerator of Qc decrease with time, the reactant concentrations and the denominator of Qc increase, and the reaction quotient consequently decreases until it becomes constant at equilibrium.
The constant value of Q exhibited by a system at equilibrium is called the equilibrium constant, K:
Comparison of the data plots in Figure 1 shows that both experimental scenarios resulted in the same value for the equilibrium constant. This is a general observation for all equilibrium systems, known as the law of mass action: At a given temperature, the reaction quotient for a system at equilibrium is constant.
Example 2: Evaluating a Reaction Quotient
Gaseous nitrogen dioxide forms dinitrogen tetroxide according to this equation:
2NO2(g)⇌N2O4(g)2NO2(g)⇌N2O4(g)
When 0.10 mol NO2 is added to a 1.0-L flask at 25 °C, the concentration changes so that at equilibrium, [NO2] = 0.016 M and [N2O4] = 0.042 M.
- What is the value of the reaction quotient before any reaction occurs?
- What is the value of the equilibrium constant for the reaction?
Check Your Learning
For the reaction 2SO2(g)+O2(g)⇌2SO3(g)2SO2(g)+O2(g)⇌2SO3(g), the concentrations at equilibrium are [SO2] = 0.90 M, [O2] = 0.35 M, and [SO3] = 1.1 M. What is the value of the equilibrium constant, Kc?
By its definition, the magnitude of an equilibrium constant explicitly reflects the composition of a reaction mixture at equilibrium, and it may be interpreted with regard to the extent of the forward reaction. A reaction exhibiting a large K will reach equilibrium when most of the reactant has been converted to product, whereas a small K indicates the reaction achieves equilibrium after very little reactant has been converted. It’s important to keep in mind that the magnitude of K does not indicate how rapidly or slowly equilibrium will be reached. Some equilibria are established so quickly as to be nearly instantaneous, and others so slowly that no perceptible change is observed over the course of days, years, or longer.
The equilibrium constant for a reaction can be used to predict the behavior of mixtures containing its reactants and/or products. As demonstrated by the sulfur dioxide oxidation process described above, a chemical reaction will proceed in whatever direction is necessary to achieve equilibrium. Comparing Q to K for an equilibrium system of interest allows prediction of what reaction (forward or reverse), if any, will occur.
To further illustrate this important point, consider the reversible reaction shown below:
CO(g)+H2O(g)⇌CO2(g)+H2(g)Kc=0.640T=800∘CCO(g)+H2O(g)⇌CO2(g)+H2(g)Kc=0.640T=800∘C
The bar charts in Figure 2 represent changes in reactant and product concentrations for three different reaction mixtures. The reaction quotients for mixtures 1 and 3 are initially lesser than the reaction’s equilibrium constant, so each of these mixtures will experience a net forward reaction to achieve equilibrium. The reaction quotient for mixture 2 is initially greater than the equilibrium constant, so this mixture will proceed in the reverse direction until equilibrium is established.
Figure 2. Figure 13.6 Compositions of three mixtures before (Qc ≠ Kc) and after (Qc = Kc) equilibrium is established for the reaction CO(g) + H2O(g) ⇌ CO2(g) + H2(g).
Example 3: Predicting the Direction of Reaction
Given below are the starting concentrations of reactants and products for three experiments involving this reaction:
CO(g)+H2O(g)⇌CO2(g)+H2(g)CO(g)+H2O(g)⇌CO2(g)+H2(g)
Kc=0.64Kc=0.64
Determine in which direction the reaction proceeds as it goes to equilibrium in each of the three experiments shown.
Reactants/Products | Experiment 1 | Experiment 2 | Experiment 3 |
---|---|---|---|
[CO]i | 0.0203 M | 0.011 M | 0.0094 M |
[H2O]i | 0.0203 M | 0.0011 M | 0.0025 M |
[CO2]i | 0.0040 M | 0.037 M | 0.0015 M |
[H2]i | 0.0040 M | 0.046 M | 0.0076 M |
Check Your Learning
Calculate the reaction quotient and determine the direction in which each of the following reactions will proceed to reach equilibrium.
- A 1.00-L flask containing 0.0500 mol of NO(g), 0.0155 mol of Cl2(g), and 0.500 mol of NOCl:
2NO(g)+Cl2(g)⇌2NOCl(g)Kc=4.6×1042NO(g)+Cl2(g)⇌2NOCl(g)Kc=4.6×104 - A 5.0-L flask containing 17 g of NH3, 14 g of N2, and 12 g of H2:
N2(g)+3H2(g)⇌2NH3(g)Kc=0.060N2(g)+3H2(g)⇌2NH3(g)Kc=0.060 - A 2.00-L flask containing 230 g of SO3(g):
2SO3(g)⇌2SO2(g)+O2(g)Kc=0.2302SO3(g)⇌2SO2(g)+O2(g)Kc=0.230
Homogeneous Equilibria
A homogeneous equilibrium is one in which all of the reactants and products are present in a single solution (by definition, a homogeneous mixture). By this definition, homogenous equilibria take place in solutions. These solutions are most commonly either liquid or gaseous phases, as shown by the examples below:
- C2H2(aq)+2Br2(aq)⇌C2H2Br4(aq)Kc=[C2H2Br4][C2H2][Br2]2C2H2(aq)+2Br2(aq)⇌C2H2Br4(aq)Kc=[C2H2Br4][C2H2][Br2]2
- I2(aq)+I−(aq)⇌I3−(aq)Kc=[I3−][I2][I−]I2(aq)+I−(aq)⇌I3−(aq)Kc=[I3−][I2][I−]
- HF(aq)+H2O(l)⇌H3O+(aq)+F-(aq)Kc=[H3O+][F−][HF]HF(aq)+H2O(l)⇌H3O+(aq)+F-(aq)Kc=[H3O+][F−][HF]
- NH3(aq)+H2O(l)⇌NH4+(aq)+OH−(aq)Kc=[NH4+][OH−][NH3]NH3(aq)+H2O(l)⇌NH4+(aq)+OH−(aq)Kc=[NH4+][OH−][NH3]
These examples all involve aqueous solutions, those in which water functions as the solvent. In the last two examples, water also functions as a reactant, but its concentration is not included in the reaction quotient. The reason for this omission is related to the more rigorous form of the Q (or K) expression mentioned previously in this chapter, in which relative concentrations for liquids and solids are equal to 1 and needn’t be included. Consequently, reaction quotients include concentration or pressure terms only for gaseous and solute species.
The equilibria below all involve gas-phase solutions:
- C2H6(g)⇌C2H4(g)+H2(g)Kc=[C2H4][H2][C2H6]C2H6(g)⇌C2H4(g)+H2(g)Kc=[C2H4][H2][C2H6]
- 3O2(g)⇌2O3(g)Kc=[O3]2[O2]33O2(g)⇌2O3(g)Kc=[O3]2[O2]3
- N2(g)+3H2(g)⇌2NH3(g)Kc=[NH3]2[N2][H2]3N2(g)+3H2(g)⇌2NH3(g)Kc=[NH3]2[N2][H2]3
- C3H8(g)+5O2(g)⇌3CO2(g)+4H2O(g)Kc=[CO2]3[H2O]4[C3H8][O2]5C3H8(g)+5O2(g)⇌3CO2(g)+4H2O(g)Kc=[CO2]3[H2O]4[C3H8][O2]5
Note that the concentration of H2O(g) has been included in the last example because water is not the solvent in this gas-phase reaction and its concentration (and activity) changes.
For gas-phase solutions, the equilibrium constant may be expressed in terms of either the molar concentrations (Kc) or partial pressures (Kp) of the reactants and products. A relation between these two K values may be simply derived from the ideal gas equation and the definition of molarity:
PV=nRTP=(nV)RT=MRTPV=nRTP=(nV)RT=MRT
where P is partial pressure, V is volume, n is molar amount, R is the gas constant, T is temperature, and M is molar concentration.
For the gas-phase reaction mA+nB⇌xC+yDmA+nB⇌xC+yD:
KP=(PC)x(PD)y(PA)m(PB)n=([C]×RT)x([D]×RT)y([A]×RT)m([B]×RT)n=[C]x[D]y[A]m[B]n×(RT)x+y(RT)m+n=Kc(RT)(x+y)−(m+n)=Kc(RT)ΔnKP=(PC)x(PD)y(PA)m(PB)n=([C]×RT)x([D]×RT)y([A]×RT)m([B]×RT)n=[C]x[D]y[A]m[B]n×(RT)x+y(RT)m+n=Kc(RT)(x+y)−(m+n)=Kc(RT)Δn
And so, the relationship between Kc and KP is
KP=Kc(RT)ΔnKP=Kc(RT)Δn
where Δn is the difference between the sum of the molar amounts of product and reactant fases, in this case:
Δn=(x+y)−(m+n)Δn=(x+y)−(m+n)
Example 4: Calculation of KP
Write the equations for the conversion of Kc to KP for each of the following reactions:
- C2H6(g)⇌C2H4(g)+H2(g)C2H6(g)⇌C2H4(g)+H2(g)
- CO(g)+H2O(g)⇌CO2(g)+H2(g)CO(g)+H2O(g)⇌CO2(g)+H2(g)
- N2(g)+3H2(g)⇌2NH3(g)N2(g)+3H2(g)⇌2NH3(g)
- Kc is equal to 0.28 for the following reaction at 900 °C: CS2(g)+4H2(g)⇌CH4(g)+2H2S(g)CS2(g)+4H2(g)⇌CH4(g)+2H2S(g)
What is KP at this temperature?
Check Your Learning
Write the equations for the conversion of Kc to KP for each of the following reactions, which occur in the gas phase:
- 2SO2(g)+O2(g)⇌2SO3(g)2SO2(g)+O2(g)⇌2SO3(g)
- N2O4(g)⇌2NO2(g)N2O4(g)⇌2NO2(g)
- C3H8(g)+5O2(g)⇌3CO2(g)+4H2O(g)C3H8(g)+5O2(g)⇌3CO2(g)+4H2O(g)
- At 227 °C, the following reaction has Kc = 0.0952: CH3OH(g)⇌CO(g)+2H2(g)CH3OH(g)⇌CO(g)+2H2(g)
What would be the value of KP at this temperature?
Heterogeneous Equilibria
A heterogeneous equilibrium involves reactants and products in two or more different phases, as illustrated by the following examples:
- PbCl2(s)⇌Pb2+(aq)+2Cl−(aq)Kc=[Pb2+][Cl−]2PbCl2(s)⇌Pb2+(aq)+2Cl−(aq)Kc=[Pb2+][Cl−]2
- CaO(s)+CO2(g)⇌CaCO3(s)Kc=1[CO2]CaO(s)+CO2(g)⇌CaCO3(s)Kc=1[CO2]
- C(s)+2S(g)⇌CS2(g)Kc=[CS2][S]2C(s)+2S(g)⇌CS2(g)Kc=[CS2][S]2
- Br2(l)⇌Br2(g)Kc=[Br2]Br2(l)⇌Br2(g)Kc=[Br2]
Two of the above examples include terms for gaseous species only in their equilibrium constants, and so Kp expressions may also be written:
- CaO(s)+CO2(g)⇌CaCO3(s)KP=1PCO2CaO(s)+CO2(g)⇌CaCO3(s)KP=1PCO2
- C(s)+2S(g)⇌CS2(g)KP=PCS2(PS)2C(s)+2S(g)⇌CS2(g)KP=PCS2(PS)2
Coupled Equilibria
The equilibrium systems discussed so far have all been relatively simple, involving just single reversible reactions. Many systems, however, involve two or more coupled equilibrium reactions, those which have in common one or more reactant or product species. Since the law of mass action allows for a straightforward derivation of equilibrium constant expressions from balanced chemical equations, the K value for a system involving coupled equilibria can be related to the K values of the individual reactions. Three basic manipulations are involved in this approach, as described below.
1. Changing the direction of a chemical equation essentially swaps the identities of “reactants” and “products,” and so the equilibrium constant for the reversed equation is simply the reciprocal of that for the forward equation.
2. Changing the stoichiometric coefficients in an equation by some factor x results in an exponential change in the equilibrium constant by that same factor:
3. Adding two or more equilibrium equations together yields an overall equation whose equilibrium constant is the mathematical product of the individual reaction’s K values:
The net reaction for these coupled equilibria is obtained by summing the two equilibrium equations and canceling any redundancies:
Comparing the equilibrium constant for the net reaction to those for the two coupled equilibrium reactions reveals the following relationship:
Example 5 demonstrates the use of this strategy in describing coupled equilibrium processes.
EXAMPLE 5: Equilibrium Constants for Coupled Reactions
A mixture containing nitrogen, hydrogen, and iodine established the following equilibrium at 400 °C:
Use the information below to calculate Kc for this reaction.
Solution
Check Your Learning
Use the provided information to calculate Kc for the following reaction at 550 °C:
Answer:
You can view the transcript for “The Equilibrium Constant” here (opens in new window).
Key Concepts and Summary
The composition of a reaction mixture may be represented by a mathematical function known as the reaction quotient, Q. For a reaction at equilibrium, the composition is constant, and Q is called the equilibrium constant, K.
A homogeneous equilibrium is an equilibrium in which all components are in the same phase. A heterogeneous equilibrium is an equilibrium in which components are in two or more phases.
Key Equations
- Q=[C]x[D]y[A]m[B]n where mA+nB⇌xC+yD
- QP=(PC)x(PD)y(PA)m(PB)n where mA+nB⇌xC+yD
- P=MRT
- KP=Kc(RT)Δn
Glossary
equilibrium constant (K): value of the reaction quotient for a system at equilibrium
heterogeneous equilibria: equilibria between reactants and products in different phases
homogeneous equilibria: equilibria within a single phase
Kc: equilibrium constant for reactions based on concentrations of reactants and products
KP: equilibrium constant for gas-phase reactions based on partial pressures of reactants and products
law of mass action: when a reversible reaction has attained equilibrium at a given temperature, the reaction quotient remains constant
reaction quotient (Q): ratio of the product of molar concentrations (or pressures) of the products to that of the reactants, each concentration (or pressure) being raised to the power equal to the coefficient in the equation
Candela Citations
- Chemistry 2e. Provided by: OpenStax. Located at: https://openstax.org/. License: CC BY: Attribution. License Terms: Access for free at https://openstax.org/books/chemistry-2e/pages/1-introduction
- The Equilibrium Constant. Authored by: Bozeman Science. Located at: https://youtu.be/xfGlEXWDRZE. License: Other. License Terms: Standard YouTube License