Exercises

Part I

  1. What is the total mass (amu) of carbon in each of the following molecules?
    1. CH4  
    2. CHCl3  
    3. C12H10O6  
    4. CH3CH2CH2CH2CH3
  2. What is the total mass of hydrogen in each of the molecules?
    1. CH4  
    2. CHCl3  
    3. C12H10O6   
    4. CH3CH2CH2CH2CH3
  3. Calculate the molecular or formula mass of each of the following:
    1. P4   
    2. H2O
    3. Ca(NO3)2   
    4. CH3CO2H (acetic acid)
    5. C12H22O11 (sucrose, cane sugar).
  4. Determine the molecular mass of the following compounds:
    1. A structure is shown. A C atom is bonded to two C l atoms and forms a double bond with one O atom.
    2. A structure is shown. Two C atoms form a triple bond with each other. Each C atom also forms a single bond with on H atom.
    3. A structure is shown. Two C atoms form double bonds with each other. Each C atom also forms a single bond with an H atom and a B r atom.
    4. A structure is shown. An S atom forms double bonds with two O atoms. The S atom also forms a single bond with an O atom which forms a single bond with an H atom. The S atom also forms a single bond with another O atom which forms a single bond with another H atom.
  5. Determine the molecular mass of the following compounds:
    1. A structure is shown. Two C atoms form double bonds with each other. The C atom on the left forms a single bond with two H atoms each. The C atom on the right forms a single bond with an H atom and with a C H subscript 2 C H subscript 3 group.
    2. A structure is shown. There is a C atom which forms single bonds with three H atoms each. This C atom is bonded to another C atom. This second C atom forms a triple bond with another C atom which forms a single bond with a fourth C atom. The fourth C atom forms single bonds with three H atoms each.
    3. A structure is shown. An S i atom forms a single bond with a C l atom, a single bond with a C l atom, a single bond with an H atom, and a single bond with another S i atom. The second S i atom froms a single bond with a C l atom, a single bond with a C l atom, and a single bond with an H atom.
    4. A structure is shown. A P atom forms a double bond with an O atom. It also forms a single bond with an O atom which forms a single bond with an H atom. It also forms a single bond with another O atom which forms a single bond with an H atom. It also forms a single bond with another O atom which forms a single bond with an H atom.
  6. Which molecule has a molecular mass of 28.05 amu?
    1. A structure is shown. A C atom forms a triple bond with another C atom. Each C atom also forms a single bond with an H atom.
    2. A structure is shown. Two C atoms form a double bond with each other. Each C atom also forms a single bond with two H atoms.
    3. A structure is shown. A C atom forms a single bond with three H atoms each and with another C atom. The second C atom also forms a single bond with three H atoms each.
  7. Write a sentence that describes how to determine the number of moles of a compound in a known mass of the compound if we know its molecular formula.
  8. Compare 1 mole of H2, 1 mole of O2, and 1 mole of F2.
    1. Which has the largest number of molecules? Explain why.
    2. Which has the greatest mass? Explain why.
  9. Which contains the greatest mass of oxygen: 0.75 mol of ethanol (C2H5OH), 0.60 mol of formic acid (HCO2H), or 1.0 mol of water (H2O)? Explain why.
  10. Which contains the greatest number of moles of oxygen atoms: 1 mol of ethanol (C2H5OH), 1 mol of formic acid (HCO2H), or 1 mol of water (H2O)? Explain why.
  11. How are the molecular mass and the molar mass of a compound similar and how are they different?
  12. Calculate the molar mass of each of the following compounds:
    1. hydrogen fluoride, HF
    2. ammonia, NH3  
    3. nitric acid, HNO3  
    4. silver sulfate, Ag2SO4  
    5. boric acid, B(OH)3
  13. Calculate the molar mass of each of the following:
    1. S8   
    2. C5H12   
    3. Sc2(SO4)3   
    4. CH3COCH3 (acetone)
    5. C6H12O6 (glucose)
  14. Calculate the empirical or molecular formula mass and the molar mass of each of the following minerals:
    1. limestone, CaCO3   
    2. halite, NaCl
    3. beryl, Be3Al2Si6O18   
    4. malachite, Cu2(OH)2CO3   
    5. turquoise, CuAl6(PO4)4(OH)8(H2O)4
  15. Calculate the molar mass of each of the following:
    1. the anesthetic halothane, C2HBrClF3  
    2. the herbicide paraquat, C12H14N2Cl2   
    3. caffeine, C8H10N4O2   
    4. urea, CO(NH2)2   
    5. a typical soap, C17H35CO2Na
  16. Determine the number of moles of compound and the number of moles of each type of atom in each of the following:
    1. 25.0 g of propylene, C3H6  
    2. 3.06×103g of the amino acid glycine, C2H5NO2   
    3. 25 lb of the herbicide Treflan, C13H16N2O4F (1 lb = 454 g)
    4. 0.125 kg of the insecticide Paris Green, Cu4(AsO3)2(CH3CO2)2   
    5. 325 mg of aspirin, C6H4(CO2H)(CO2CH3)
  17. Determine the mass of each of the following:
    1. 0.0146 mol KOH
    2. 10.2 mol ethane, C2H6   
    3. 1.6×103 mol Na2SO4
    4. 6.854×103 mol glucose,C6H12O6
    5. 2.86 mol Co(NH3)6Cl3
  18. Determine the number of moles of the compound and determine the number of moles of each type of atom in each of the following:
    1. 2.12 g of potassium bromide, KBr
    2. 0.1488 g of phosphoric acid, H3PO4  
    3. 23 kg of calcium carbonate, CaCO3  
    4. 78.452 g of aluminum sulfate, Al2(SO4)3  
    5. 0.1250 mg of caffeine, C8H10N4O2
  19. Determine the mass of each of the following:
    1. 2.345 mol LiCl
    2. 0.0872 mol acetylene, C2H2   
    3. 3.3×102 mol Na2CO3
    4. 1.23×103 mol fructose, C6H12O6
    5. 0.5758 mol FeSO4(H2O)7
  20. The approximate minimum daily dietary requirement of the amino acid leucine, C6H13NO2, is 1.1 g. What is this requirement in moles?
  21. Determine the mass in grams of each of the following:
    1. 0.600 mol of oxygen atoms
    2. 0.600 mol of oxygen molecules, O2   
    3. 0.600 mol of ozone molecules, O3
  22. A 55-kg woman has 7.5×103mol of hemoglobin (molar mass = 64,456 g/mol) in her blood. How many hemoglobin molecules is this? What is this quantity in grams?
  23. Determine the number of atoms and the mass of zirconium, silicon, and oxygen found in 0.3384 mol of zircon, ZrSiO4, a semiprecious stone.
  24. Determine which of the following contains the greatest mass of hydrogen: 1 mol of CH4, 0.6 mol of C6H6, or 0.4 mol of C3H8.
  25. Determine which of the following contains the greatest mass of aluminum: 122 g of AlPO4, 266 g of A12C16, or 225 g of A12S3.
  26. Diamond is one form of elemental carbon. An engagement ring contains a diamond weighing 1.25 carats (1 carat = 200 mg). How many atoms are present in the diamond?
  27. The Cullinan diamond was the largest natural diamond ever found (January 25, 1905). It weighed 3104 carats (1 carat = 200 mg). How many carbon atoms were present in the stone
  28. One 55-gram serving of a particular cereal supplies 270 mg of sodium, 11% of the recommended daily allowance. How many moles and atoms of sodium are in the recommended daily allowance?
  29. A certain nut crunch cereal contains 11.0 grams of sugar (sucrose, C12H22O11) per serving size of 60.0 grams. How many servings of this cereal must be eaten to consume 0.0278 moles of sugar?
  30. A tube of toothpaste contains 0.76 g of sodium monofluorophosphate (Na2PO3F) in 100 mL
    1. What mass of fluorine atoms in mg was present?
    2. How many fluorine atoms were present?
  31. Which of the following represents the least number of molecules?
    1. 20.0 g of H2O (18.02 g/mol)
    2. 77.0 g of CH4 (16.06 g/mol)
    3. 68.0 g of CaH2 (42.09 g/mol)
    4. 100.0 g of N2O (44.02 g/mol)
    5. 84.0 g of HF (20.01 g/mol)

Part II

  1. Write the balanced equation, then outline the steps necessary to determine the information requested in each of the following:
    1. The number of moles and the mass of chlorine, Cl2, required to react with 10.0 g of sodium metal, Na, to produce sodium chloride, NaCl.
    2. The number of moles and the mass of oxygen formed by the decomposition of 1.252 g of mercury(II) oxide.
    3. The number of moles and the mass of sodium nitrate, NaNO3, required to produce 128 g of oxygen. (NaNO2 is the other product.)
    4. The number of moles and the mass of carbon dioxide formed by the combustion of 20.0 kg of carbon in an excess of oxygen.
    5. The number of moles and the mass of copper(II) carbonate needed to produce 1.500 kg of copper(II) oxide. (CO2 is the other product.)
    6. This figure includes two structural formulas. It reads, “The number of moles and the mass of,” which is followed by a structure with two C atoms bonded with a single horizontal at the center. Both C atoms have H atoms bonded above and below. The C atom to the left has a B r atom bonded to its left. The C atom to the right has a B r atom bonded to its right. Following this structure, the figure reads, “formed by the reaction of 12.85 g of,” which is followed by a structure with two C atoms connected with a horizontal double bond. The C atom to the left has H atoms bonded above and to the left and below and to the left. The C atom to the right has H atoms bonded above and to the right and below and to the right. The figure ends with, “with an excess of B r subscript 2.”
  2. Determine the number of moles and the mass requested for each reaction in Exercise 1.
  3. Write the balanced equation, then outline the steps necessary to determine the information requested in each of the following:
    1. The number of moles and the mass of Mg required to react with 5.00 g of HCl and produce MgCl2 and H2.
    2. The number of moles and the mass of oxygen formed by the decomposition of 1.252 g of silver(I) oxide.
    3. The number of moles and the mass of magnesium carbonate, MgCO3, required to produce 283 g of carbon dioxide. (MgO is the other product.)
    4. The number of moles and the mass of water formed by the combustion of 20.0 kg of acetylene, C2H2, in an excess of oxygen.
    5. The number of moles and the mass of barium peroxide, BaO2, needed to produce 2.500 kg of barium oxide, BaO (O2 is the other product.)
    6. This figure includes two structural formulas. It reads, “The number of moles and the mass of,” which is followed by a structure with two C atoms connected with a horizontal double bond at the center. The C atom to the left has H atoms bonded above and to the left and below and to the left. The C atom to the right has H atoms bonded above and to the right and below and to the right. Following this structure, the figure reads, “required to react with H subscript 2 O to produce 9.55 g of,” which is followed by a structure with two C atoms connected with a horizontal single bond. The C atom to the left has H atoms bonded above, to the left, and below. The C atom to the right has H atoms bonded above and below. To the right, an O atom forms a single bond with the C atom. A single H atom is bonded to the right side of the O atom.
  4. Determine the number of moles and the mass requested for each reaction in Exercise 3.
  5. H2 is produced by the reaction of 118.5 mL of a 0.8775-M solution of H3PO4 according to the following equation: 2Cr+2H3PO43H2+2CrPO4.
    1. Outline the steps necessary to determine the number of moles and mass of H2.
    2. Perform the calculations outlined.
  6. Gallium chloride is formed by the reaction of 2.6 L of a 1.44 M solution of HCl according to the following equation: 2Ga+6HCl2GaCl3+3H2.
    1. Outline the steps necessary to determine the number of moles and mass of gallium chloride.
    2. Perform the calculations outlined.
  7. I2 is produced by the reaction of 0.4235 mol of CuCl2 according to the following equation: 2CuCl2+4KI2CuI+4KCl+I2.
    1. How many molecules of I2 are produced?
    2. What mass of I2 is produced?
  8. Silver is often extracted from ores as K[Ag(CN)2] and then recovered by the reaction 2K[Ag(CN)2](aq)+Zn(s)2Ag(s)+Zn(CN)2(aq)+2KCN(aq)
    1. How many molecules of Zn(CN)2 are produced by the reaction of 35.27 g of K[Ag(CN)2]?
    2. What mass of Zn(CN)2 is produced?
  9. What mass of silver oxide, Ag2O, is required to produce 25.0 g of silver sulfadiazine, AgC10H9N4SO2, from the reaction of silver oxide and sulfadiazine? 2C10H10N4SO2+Ag2O2AgC10H9N4SO2+H2O
  10. Carborundum is silicon carbide, SiC, a very hard material used as an abrasive on sandpaper and in other applications. It is prepared by the reaction of pure sand, SiO2, with carbon at high temperature. Carbon monoxide, CO, is the other product of this reaction. Write the balanced equation for the reaction, and calculate how much SiO2 is required to produce 3.00 kg of SiC.
  11. Automotive air bags inflate when a sample of sodium azide, NaN3, is very rapidly decomposed.2NaN3(s)2Na(s)+3N2(g) What mass of sodium azide is required to produce 2.6 ft3 (73.6 L) of nitrogen gas with a density of 1.25 g/L?
  12. Urea, CO(NH2)2, is manufactured on a large scale for use in producing urea-formaldehyde plastics and as a fertilizer. What is the maximum mass of urea that can be manufactured from the CO2 produced by combustion of 1.00×103kg of carbon followed by the reaction? CO2(g)+2NH3(g)CO(NH2)2(s)+H2O(l)
  13. In an accident, a solution containing 2.5 kg of nitric acid was spilled. Two kilograms of Na2CO3 was quickly spread on the area and CO2 was released by the reaction. Was sufficient Na2CO3 used to neutralize all of the acid?
  14. A compact car gets 37.5 miles per gallon on the highway. If gasoline contains 84.2% carbon by mass and has a density of 0.8205 g/mL, determine the mass of carbon dioxide produced during a 500-mile trip (3.785 liters per gallon).
  15. What volume of a 0.750 M solution of hydrochloric acid, a solution of HCl, can be prepared from the HCl produced by the reaction of 25.0 g of NaCl with an excess of sulfuric acid? NaCl(s)+H2SO4(l)HCl(g)+NaHSO4(s)
  16. What volume of a 0.2089 M KI solution contains enough KI to react exactly with the Cu(NO3)2 in 43.88 mL of a 0.3842 M solution of Cu(NO3)2? 2Cu(NO3)2+4KI2CuI+I2+4KNO3
  17. A mordant is a substance that combines with a dye to produce a stable fixed color in a dyed fabric. Calcium acetate is used as a mordant. It is prepared by the reaction of acetic acid with calcium hydroxide.2CH3CO2H+Ca(OH)2Ca(CH3CO2)2+2H2O What mass of Ca(OH)2 is required to react with the acetic acid in 25.0 mL of a solution having a density of 1.065 g/mL and containing 58.0% acetic acid by mass?
  18. The toxic pigment called white lead, Pb3(OH)2(CO3)2, has been replaced in white paints by rutile, TiO2. How much rutile (g) can be prepared from 379 g of an ore that contains 88.3% ilmenite (FeTiO3) by mass?2FeTiO3+4HCl+Cl22FeCl3+2TiO2+2H2O

Part III

  1. Calculate the following to four significant figures:
    1. the percent composition of ammonia, NH3  
    2. the percent composition of photographic “hypo,” Na2S2O3  
    3. the percent of calcium ion in Ca3(PO4)2
  2. Determine the following to four significant figures:
    1. the percent composition of hydrazoic acid, HN3  
    2. the percent composition of TNT, C6H2(CH3)(NO2)3  
    3. the percent of SO42– in Al2(SO4)3
  3. Determine the percent ammonia, NH3, in Co(NH3)6Cl3, to three significant figures.
  4. Determine the percent water in CuSO4∙5H2O to three significant figures.

Part IV

  1. What information do we need to determine the molecular formula of a compound from the empirical formula?
  2. Determine the empirical formulas for compounds with the following percent compositions:
    1. 15.8% carbon and 84.2% sulfur
    2. 40.0% carbon, 6.7% hydrogen, and 53.3% oxygen
  3. Determine the empirical formulas for compounds with the following percent compositions:
    1. 43.6% phosphorus and 56.4% oxygen
    2. 28.7% K, 1.5% H, 22.8% P, and 47.0% O
  4. Polymers are large molecules composed of simple units repeated many times. Thus, they often have relatively simple empirical formulas. Calculate the empirical formulas of the following polymers:
    1. Lucite (Plexiglas); 59.9% C, 8.06% H, 32.0% O
    2. Saran; 24.8% C, 2.0% H, 73.1% Cl
    3. polyethylene; 86% C, 14% H
    4. polystyrene; 92.3% C, 7.7% H
    5. Orlon; 67.9% C, 5.70% H, 26.4% N
  5. A compound of carbon and hydrogen contains 92.3% C and has a molar mass of 78.1 g/mol. What is its molecular formula?
  6. Dichloroethane, a compound that is often used for dry cleaning, contains carbon, hydrogen, and chlorine. It has a molar mass of 99 g/mol. Analysis of a sample shows that it contains 24.3% carbon and 4.1% hydrogen. What is its molecular formula?
  7. Determine the empirical and molecular formula for chrysotile asbestos. Chrysotile has the following percent composition: 28.03% Mg, 21.60% Si, 1.16% H, and 49.21% O. The molar mass for chrysotile is 520.8 g/mol.
  8. A major textile dye manufacturer developed a new yellow dye. The dye has a percent composition of 75.95% C, 17.72% N, and 6.33% H by mass with a molar mass of about 240 g/mol. Determine the molecular formula of the dye.

Part V

  1. What mass of CO2 is produced by the combustion of 1.00 mol of CH4?

    CH4(g) + 2O2(g) → CO2(g) + 2H2O(ℓ)

  2. What mass of H2O is produced by the combustion of 1.00 mol of CH4?

    CH4(g) + 2O2(g) → CO2(g) + 2H2O(ℓ)

  3. What mass of HgO is required to produce 0.692 mol of O2?

    2HgO(s) → 2Hg(ℓ) + O2(g)

  4. What mass of NaHCO3 is needed to produce 2.659 mol of CO2?

    2NaHCO3(s) → Na2CO3(s) + H2O(ℓ) + CO2(g)

  5. How many moles of Al can be produced from 10.87 g of Ag?

    Al(NO33(s) + 3Ag → Al + 3AgNO3

  6. How many moles of HCl can be produced from 0.226 g of SOCl2?

    SOCl2(ℓ) + H2O(ℓ) → SO2(g) + 2HCl(g)

  7. How many moles of O2 are needed to prepare 1.00 g of Ca(NO3)2?

    Ca(s) + N2(g) + 3O2(g) → Ca(NO32(s)

  8. How many moles of C2H5OH are needed to generate 106.7 g of H2O?

    C2H5OH(ℓ) + 3O2(g) → 2CO2(g) + 3H2O(ℓ)

  9. What mass of O2 can be generated by the decomposition of 100.0 g of NaClO3?

    2NaClO3 → 2NaCl(s) + 3O2(g)

  10. What mass of Li2O is needed to react with 1,060 g of CO2?

    Li2O(aq) + CO2(g) → Li2CO3(aq)

  11. What mass of Fe2O3 must be reacted to generate 324 g of Al2O3?

    Fe2O3(s) + 2Al(s) → 2Fe(s) + Al2O3(s)

  12. What mass of Fe is generated when 100.0 g of Al are reacted?

    Fe2O3(s) + 2Al(s) → 2Fe(s) + Al2O3(s)

  13. What mass of MnO2 is produced when 445 g of H2O are reacted?

    H2O(ℓ) + 2MnO4(aq) + Br(aq) → BrO3(aq) + 2MnO2(s) + 2OH(aq)

  14. What mass of PbSO4 is produced when 29.6 g of H2SO4 are reacted?

    Pb(s) + PbO2(s) + 2H2SO4(aq) → 2PbSO4(s) + 2H2O(ℓ)

  15. If 83.9 g of ZnO are formed, what mass of Mn2O3 is formed with it?

    Zn(s) + 2MnO2(s) → ZnO(s) + Mn2O3(s)

  16. If 14.7 g of NO2 are reacted, what mass of H2O is reacted with it?

    3NO2(g) + H2O(ℓ) → 2HNO3(aq) + NO(g)

  17. If 88.4 g of CH2S are reacted, what mass of HF is produced?

    CH2S + 6F2 → CF4 + 2HF + SF6

  18. If 100.0 g of Cl2 are needed, what mass of NaOCl must be reacted?

    NaOCl + HCl → NaOH + Cl2